C16H21NO3S2 — CID 120540538
2-[[2-(1,4-dithian-2-yl)acetyl]-(2-phenylethyl)amino]acetic acid (PubChem CID 120540538) has the molecular formula C16H21NO3S2 and a molecular weight of 339.48 g/mol. Its IUPAC name is 2-[[2-(1,4-dithian-2-yl)acetyl]-(2-phenylethyl)amino]acetic acid.
| Compound Name | 2-[[2-(1,4-dithian-2-yl)acetyl]-(2-phenylethyl)amino]acetic acid |
|---|---|
| PubChem CID | 120540538 |
| Molecular Formula | C16H21NO3S2 |
| Molecular Weight | 339.48 g/mol |
| Exact Mass | 339.10 |
| IUPAC Name | 2-[[2-(1,4-dithian-2-yl)acetyl]-(2-phenylethyl)amino]acetic acid |
| SMILES | O=C(O)CN(CCc1ccccc1)C(=O)CC1CSCCS1 |
| InChI | InChI=1S/C16H21NO3S2/c18-15(10-14-12-21-8-9-22-14)17(11-16(19)20)7-6-13-4-2-1-3-5-13/h1-5,14H,6-12H2,(H,19,20) |
| InChIKey | BYKKVTLMUBBMOL-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.48 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |