C13H17NOS2 — CID 112760137
N-benzyl-N-methyl-1,4-dithiane-2-carboxamide (PubChem CID 112760137) has the molecular formula C13H17NOS2 and a molecular weight of 267.42 g/mol. Its IUPAC name is N-benzyl-N-methyl-1,4-dithiane-2-carboxamide.
| Compound Name | N-benzyl-N-methyl-1,4-dithiane-2-carboxamide |
|---|---|
| PubChem CID | 112760137 |
| Molecular Formula | C13H17NOS2 |
| Molecular Weight | 267.42 g/mol |
| Exact Mass | 267.08 |
| IUPAC Name | N-benzyl-N-methyl-1,4-dithiane-2-carboxamide |
| SMILES | CN(Cc1ccccc1)C(=O)C1CSCCS1 |
| InChI | InChI=1S/C13H17NOS2/c1-14(9-11-5-3-2-4-6-11)13(15)12-10-16-7-8-17-12/h2-6,12H,7-10H2,1H3 |
| InChIKey | ILIDCRTUMUNMQA-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.42 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |