C17H19NO2S2 — CID 112761172
N-benzyl-N-(furan-2-ylmethyl)-1,4-dithiane-2-carboxamide (PubChem CID 112761172) has the molecular formula C17H19NO2S2 and a molecular weight of 333.48 g/mol. Its IUPAC name is N-benzyl-N-(furan-2-ylmethyl)-1,4-dithiane-2-carboxamide.
| Compound Name | N-benzyl-N-(furan-2-ylmethyl)-1,4-dithiane-2-carboxamide |
|---|---|
| PubChem CID | 112761172 |
| Molecular Formula | C17H19NO2S2 |
| Molecular Weight | 333.48 g/mol |
| Exact Mass | 333.09 |
| IUPAC Name | N-benzyl-N-(furan-2-ylmethyl)-1,4-dithiane-2-carboxamide |
| SMILES | O=C(C1CSCCS1)N(Cc1ccccc1)Cc1ccco1 |
| InChI | InChI=1S/C17H19NO2S2/c19-17(16-13-21-9-10-22-16)18(12-15-7-4-8-20-15)11-14-5-2-1-3-6-14/h1-8,16H,9-13H2 |
| InChIKey | YAEJNMNOGDUQJV-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 33.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.48 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |