C17H23NO5S — CID 120536394
4-[benzyl-(1,1-dioxothiane-2-carbonyl)amino]butanoic acid (PubChem CID 120536394) has the molecular formula C17H23NO5S and a molecular weight of 353.44 g/mol. Its IUPAC name is 4-[benzyl-(1,1-dioxothiane-2-carbonyl)amino]butanoic acid.
| Compound Name | 4-[benzyl-(1,1-dioxothiane-2-carbonyl)amino]butanoic acid |
|---|---|
| PubChem CID | 120536394 |
| Molecular Formula | C17H23NO5S |
| Molecular Weight | 353.44 g/mol |
| Exact Mass | 353.13 |
| IUPAC Name | 4-[benzyl-(1,1-dioxothiane-2-carbonyl)amino]butanoic acid |
| SMILES | O=C(O)CCCN(Cc1ccccc1)C(=O)C1CCCCS1(=O)=O |
| InChI | InChI=1S/C17H23NO5S/c19-16(20)10-6-11-18(13-14-7-2-1-3-8-14)17(21)15-9-4-5-12-24(15,22)23/h1-3,7-8,15H,4-6,9-13H2,(H,19,20) |
| InChIKey | HTJUPODUGFACNH-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 91.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.44 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |