C16H23BrN2O3 — CID 119771874
ethyl 3-(4-bromophenyl)-3-[[2-methyl-3-(methylamino)propanoyl]amino]propanoate (PubChem CID 119771874) has the molecular formula C16H23BrN2O3 and a molecular weight of 371.28 g/mol. Its IUPAC name is ethyl 3-(4-bromophenyl)-3-[[2-methyl-3-(methylamino)propanoyl]amino]propanoate.
| Compound Name | ethyl 3-(4-bromophenyl)-3-[[2-methyl-3-(methylamino)propanoyl]amino]propanoate |
|---|---|
| PubChem CID | 119771874 |
| Molecular Formula | C16H23BrN2O3 |
| Molecular Weight | 371.28 g/mol |
| Exact Mass | 370.09 |
| IUPAC Name | ethyl 3-(4-bromophenyl)-3-[[2-methyl-3-(methylamino)propanoyl]amino]propanoate |
| SMILES | CCOC(=O)CC(NC(=O)C(C)CNC)c1ccc(Br)cc1 |
| InChI | InChI=1S/C16H23BrN2O3/c1-4-22-15(20)9-14(12-5-7-13(17)8-6-12)19-16(21)11(2)10-18-3/h5-8,11,14,18H,4,9-10H2,1-3H3,(H,19,21) |
| InChIKey | PEHXNDBLAGLORC-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.28 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |