C13H16F2O3 — CID 146576795
ethyl 4-(3,4-difluorophenyl)-4-hydroxy-3-methylbutanoate (PubChem CID 146576795) has the molecular formula C13H16F2O3 and a molecular weight of 258.26 g/mol. Its IUPAC name is ethyl 4-(3,4-difluorophenyl)-4-hydroxy-3-methylbutanoate.
| Compound Name | ethyl 4-(3,4-difluorophenyl)-4-hydroxy-3-methylbutanoate |
|---|---|
| PubChem CID | 146576795 |
| Molecular Formula | C13H16F2O3 |
| Molecular Weight | 258.26 g/mol |
| Exact Mass | 258.11 |
| IUPAC Name | ethyl 4-(3,4-difluorophenyl)-4-hydroxy-3-methylbutanoate |
| SMILES | CCOC(=O)CC(C)C(O)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C13H16F2O3/c1-3-18-12(16)6-8(2)13(17)9-4-5-10(14)11(15)7-9/h4-5,7-8,13,17H,3,6H2,1-2H3 |
| InChIKey | OCBMTPFWJCWKOP-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.26 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |