C12H15F2NO3 — CID 11334430
ethyl N-[1-(3,4-difluorophenyl)-2-hydroxypropyl]carbamate (PubChem CID 11334430) has the molecular formula C12H15F2NO3 and a molecular weight of 259.25 g/mol. Its IUPAC name is ethyl N-[1-(3,4-difluorophenyl)-2-hydroxypropyl]carbamate.
| Compound Name | ethyl N-[1-(3,4-difluorophenyl)-2-hydroxypropyl]carbamate |
|---|---|
| PubChem CID | 11334430 |
| Molecular Formula | C12H15F2NO3 |
| Molecular Weight | 259.25 g/mol |
| Exact Mass | 259.10 |
| IUPAC Name | ethyl N-[1-(3,4-difluorophenyl)-2-hydroxypropyl]carbamate |
| SMILES | CCOC(=O)NC(c1ccc(F)c(F)c1)C(C)O |
| InChI | InChI=1S/C12H15F2NO3/c1-3-18-12(17)15-11(7(2)16)8-4-5-9(13)10(14)6-8/h4-7,11,16H,3H2,1-2H3,(H,15,17) |
| InChIKey | QYEVVXBUBRJONS-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.25 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |