C13H17F2NO3 — CID 22452677
ethyl N-[2-(3,4-difluorophenyl)-4-hydroxybutyl]carbamate (PubChem CID 22452677) has the molecular formula C13H17F2NO3 and a molecular weight of 273.28 g/mol. Its IUPAC name is ethyl N-[2-(3,4-difluorophenyl)-4-hydroxybutyl]carbamate.
| Compound Name | ethyl N-[2-(3,4-difluorophenyl)-4-hydroxybutyl]carbamate |
|---|---|
| PubChem CID | 22452677 |
| Molecular Formula | C13H17F2NO3 |
| Molecular Weight | 273.28 g/mol |
| Exact Mass | 273.12 |
| IUPAC Name | ethyl N-[2-(3,4-difluorophenyl)-4-hydroxybutyl]carbamate |
| SMILES | CCOC(=O)NCC(CCO)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C13H17F2NO3/c1-2-19-13(18)16-8-10(5-6-17)9-3-4-11(14)12(15)7-9/h3-4,7,10,17H,2,5-6,8H2,1H3,(H,16,18) |
| InChIKey | UYZZLEKBMBCOCW-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.28 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |