C14H20F2N2O2 — CID 111503722
1-[1-(3,4-difluorophenyl)ethyl]-3-(4-hydroxy-2-methylbutyl)urea (PubChem CID 111503722) has the molecular formula C14H20F2N2O2 and a molecular weight of 286.32 g/mol. Its IUPAC name is 1-[1-(3,4-difluorophenyl)ethyl]-3-(4-hydroxy-2-methylbutyl)urea.
| Compound Name | 1-[1-(3,4-difluorophenyl)ethyl]-3-(4-hydroxy-2-methylbutyl)urea |
|---|---|
| PubChem CID | 111503722 |
| Molecular Formula | C14H20F2N2O2 |
| Molecular Weight | 286.32 g/mol |
| Exact Mass | 286.15 |
| IUPAC Name | 1-[1-(3,4-difluorophenyl)ethyl]-3-(4-hydroxy-2-methylbutyl)urea |
| SMILES | CC(CCO)CNC(=O)NC(C)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C14H20F2N2O2/c1-9(5-6-19)8-17-14(20)18-10(2)11-3-4-12(15)13(16)7-11/h3-4,7,9-10,19H,5-6,8H2,1-2H3,(H2,17,18,20) |
| InChIKey | IQOSOCATYYSTSB-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.32 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |