C15H22F2N2O2 — CID 111506835
1-[1-(2,5-difluorophenyl)propyl]-3-(4-hydroxy-2-methylbutyl)urea (PubChem CID 111506835) has the molecular formula C15H22F2N2O2 and a molecular weight of 300.35 g/mol. Its IUPAC name is 1-[1-(2,5-difluorophenyl)propyl]-3-(4-hydroxy-2-methylbutyl)urea.
| Compound Name | 1-[1-(2,5-difluorophenyl)propyl]-3-(4-hydroxy-2-methylbutyl)urea |
|---|---|
| PubChem CID | 111506835 |
| Molecular Formula | C15H22F2N2O2 |
| Molecular Weight | 300.35 g/mol |
| Exact Mass | 300.16 |
| IUPAC Name | 1-[1-(2,5-difluorophenyl)propyl]-3-(4-hydroxy-2-methylbutyl)urea |
| SMILES | CCC(NC(=O)NCC(C)CCO)c1cc(F)ccc1F |
| InChI | InChI=1S/C15H22F2N2O2/c1-3-14(12-8-11(16)4-5-13(12)17)19-15(21)18-9-10(2)6-7-20/h4-5,8,10,14,20H,3,6-7,9H2,1-2H3,(H2,18,19,21) |
| InChIKey | VEGVZZJBAAHRRB-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.35 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |