C16H18F2N2O2S — CID 111456030
1-[1-(2,5-difluorophenyl)propyl]-3-(2-hydroxy-2-thiophen-3-ylethyl)urea (PubChem CID 111456030) has the molecular formula C16H18F2N2O2S and a molecular weight of 340.40 g/mol. Its IUPAC name is 1-[1-(2,5-difluorophenyl)propyl]-3-(2-hydroxy-2-thiophen-3-ylethyl)urea.
| Compound Name | 1-[1-(2,5-difluorophenyl)propyl]-3-(2-hydroxy-2-thiophen-3-ylethyl)urea |
|---|---|
| PubChem CID | 111456030 |
| Molecular Formula | C16H18F2N2O2S |
| Molecular Weight | 340.40 g/mol |
| Exact Mass | 340.11 |
| IUPAC Name | 1-[1-(2,5-difluorophenyl)propyl]-3-(2-hydroxy-2-thiophen-3-ylethyl)urea |
| SMILES | CCC(NC(=O)NCC(O)c1ccsc1)c1cc(F)ccc1F |
| InChI | InChI=1S/C16H18F2N2O2S/c1-2-14(12-7-11(17)3-4-13(12)18)20-16(22)19-8-15(21)10-5-6-23-9-10/h3-7,9,14-15,21H,2,8H2,1H3,(H2,19,20,22) |
| InChIKey | YBDLLFOYXSEKSD-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.40 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |