C15H12F4N2O — CID 47033191
1-(3,5-difluorophenyl)-3-[1-(3,4-difluorophenyl)ethyl]urea (PubChem CID 47033191) has the molecular formula C15H12F4N2O and a molecular weight of 312.27 g/mol. Its IUPAC name is 1-(3,5-difluorophenyl)-3-[1-(3,4-difluorophenyl)ethyl]urea.
| Compound Name | 1-(3,5-difluorophenyl)-3-[1-(3,4-difluorophenyl)ethyl]urea |
|---|---|
| PubChem CID | 47033191 |
| Molecular Formula | C15H12F4N2O |
| Molecular Weight | 312.27 g/mol |
| Exact Mass | 312.09 |
| IUPAC Name | 1-(3,5-difluorophenyl)-3-[1-(3,4-difluorophenyl)ethyl]urea |
| SMILES | CC(NC(=O)Nc1cc(F)cc(F)c1)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C15H12F4N2O/c1-8(9-2-3-13(18)14(19)4-9)20-15(22)21-12-6-10(16)5-11(17)7-12/h2-8H,1H3,(H2,20,21,22) |
| InChIKey | XLNHOWUOPDSOEI-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.27 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |