About 1-[(1R)-1-(3,4-difluorophenyl)ethyl]-3-(4-methyl-6-oxo-1H-pyridin-3-yl)urea
1-[(1R)-1-(3,4-difluorophenyl)ethyl]-3-(4-methyl-6-oxo-1H-pyridin-3-yl)urea (PubChem CID 95975263) has the molecular formula C15H15F2N3O2
and a molecular weight of 307.30 g/mol. Its IUPAC name is 1-[(1R)-1-(3,4-difluorophenyl)ethyl]-3-(4-methyl-6-oxo-1H-pyridin-3-yl)urea.
Molecular Properties
| Compound Name | 1-[(1R)-1-(3,4-difluorophenyl)ethyl]-3-(4-methyl-6-oxo-1H-pyridin-3-yl)urea |
| PubChem CID | 95975263 |
| Molecular Formula | C15H15F2N3O2 |
| Molecular Weight | 307.30 g/mol |
| Exact Mass | 307.11 |
| IUPAC Name | 1-[(1R)-1-(3,4-difluorophenyl)ethyl]-3-(4-methyl-6-oxo-1H-pyridin-3-yl)urea |
| SMILES | Cc1cc(=O)[nH]cc1NC(=O)N[C@H](C)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C15H15F2N3O2/c1-8-5-14(21)18-7-13(8)20-15(22)19-9(2)10-3-4-11(16)12(17)6-10/h3-7,9H,1-2H3,(H,18,21)(H2,19,20,22)/t9-/m1/s1 |
| InChIKey | LVNIEPRBAIVRAW-SECBINFHSA-N |
| XLogP | 2.84 |
| TPSA | 73.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.30 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[(1R)-1-(3,4-difluorophenyl)ethyl]-3-(4-methyl-6-oxo-1H-pyridin-3-yl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(1R)-1-(3,4-difluorophenyl)ethyl]-3-(4-methyl-6-oxo-1H-pyridin-3-yl)urea?
The IUPAC name of 1-[(1R)-1-(3,4-difluorophenyl)ethyl]-3-(4-methyl-6-oxo-1H-pyridin-3-yl)urea (CID 95975263) is 1-[(1R)-1-(3,4-difluorophenyl)ethyl]-3-(4-methyl-6-oxo-1H-pyridin-3-yl)urea.
What is the SMILES notation for 1-[(1R)-1-(3,4-difluorophenyl)ethyl]-3-(4-methyl-6-oxo-1H-pyridin-3-yl)urea?
The canonical SMILES for 1-[(1R)-1-(3,4-difluorophenyl)ethyl]-3-(4-methyl-6-oxo-1H-pyridin-3-yl)urea is Cc1cc(=O)[nH]cc1NC(=O)N[C@H](C)c1ccc(F)c(F)c1.
What is the InChIKey of 1-[(1R)-1-(3,4-difluorophenyl)ethyl]-3-(4-methyl-6-oxo-1H-pyridin-3-yl)urea?
The InChIKey is LVNIEPRBAIVRAW-SECBINFHSA-N. The full InChI is InChI=1S/C15H15F2N3O2/c1-8-5-14(21)18-7-13(8)20-15(22)19-9(2)10-3-4-11(16)12(17)6-10/h3-7,9H,1-2H3,(H,18,21)(H2,19,20,22)/t9-/m1/s1.
What are the key properties of 1-[(1R)-1-(3,4-difluorophenyl)ethyl]-3-(4-methyl-6-oxo-1H-pyridin-3-yl)urea?
1-[(1R)-1-(3,4-difluorophenyl)ethyl]-3-(4-methyl-6-oxo-1H-pyridin-3-yl)urea has a molecular weight of 307.30 g/mol, XLogP of 2.84, 3 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(1R)-1-(3,4-difluorophenyl)ethyl]-3-(4-methyl-6-oxo-1H-pyridin-3-yl)urea is sourced from PubChem (CID 95975263), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).