C16H16F2N2O2 — CID 27869518
1-[(1S)-1-(3,4-difluorophenyl)ethyl]-3-(2-methoxyphenyl)urea (PubChem CID 27869518) has the molecular formula C16H16F2N2O2 and a molecular weight of 306.31 g/mol. Its IUPAC name is 1-[(1S)-1-(3,4-difluorophenyl)ethyl]-3-(2-methoxyphenyl)urea.
| Compound Name | 1-[(1S)-1-(3,4-difluorophenyl)ethyl]-3-(2-methoxyphenyl)urea |
|---|---|
| PubChem CID | 27869518 |
| Molecular Formula | C16H16F2N2O2 |
| Molecular Weight | 306.31 g/mol |
| Exact Mass | 306.12 |
| IUPAC Name | 1-[(1S)-1-(3,4-difluorophenyl)ethyl]-3-(2-methoxyphenyl)urea |
| SMILES | COc1ccccc1NC(=O)N[C@@H](C)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C16H16F2N2O2/c1-10(11-7-8-12(17)13(18)9-11)19-16(21)20-14-5-3-4-6-15(14)22-2/h3-10H,1-2H3,(H2,19,20,21)/t10-/m0/s1 |
| InChIKey | RWZBXCUBCFKACD-JTQLQIEISA-N |
| XLogP | 3.86 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.31 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |