C18H20F2N2O — CID 112825000
1-[1-(3,4-difluorophenyl)ethyl]-3-(4-propylphenyl)urea (PubChem CID 112825000) has the molecular formula C18H20F2N2O and a molecular weight of 318.37 g/mol. Its IUPAC name is 1-[1-(3,4-difluorophenyl)ethyl]-3-(4-propylphenyl)urea.
| Compound Name | 1-[1-(3,4-difluorophenyl)ethyl]-3-(4-propylphenyl)urea |
|---|---|
| PubChem CID | 112825000 |
| Molecular Formula | C18H20F2N2O |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.15 |
| IUPAC Name | 1-[1-(3,4-difluorophenyl)ethyl]-3-(4-propylphenyl)urea |
| SMILES | CCCc1ccc(NC(=O)NC(C)c2ccc(F)c(F)c2)cc1 |
| InChI | InChI=1S/C18H20F2N2O/c1-3-4-13-5-8-15(9-6-13)22-18(23)21-12(2)14-7-10-16(19)17(20)11-14/h5-12H,3-4H2,1-2H3,(H2,21,22,23) |
| InChIKey | HDBFRAYUPCVMNI-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.37 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |