C20H21F2N3O2 — CID 47033453
1-[1-(3,4-difluorophenyl)ethyl]-3-[4-(pyrrolidine-1-carbonyl)phenyl]urea (PubChem CID 47033453) has the molecular formula C20H21F2N3O2 and a molecular weight of 373.40 g/mol. Its IUPAC name is 1-[1-(3,4-difluorophenyl)ethyl]-3-[4-(pyrrolidine-1-carbonyl)phenyl]urea.
| Compound Name | 1-[1-(3,4-difluorophenyl)ethyl]-3-[4-(pyrrolidine-1-carbonyl)phenyl]urea |
|---|---|
| PubChem CID | 47033453 |
| Molecular Formula | C20H21F2N3O2 |
| Molecular Weight | 373.40 g/mol |
| Exact Mass | 373.16 |
| IUPAC Name | 1-[1-(3,4-difluorophenyl)ethyl]-3-[4-(pyrrolidine-1-carbonyl)phenyl]urea |
| SMILES | CC(NC(=O)Nc1ccc(C(=O)N2CCCC2)cc1)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C20H21F2N3O2/c1-13(15-6-9-17(21)18(22)12-15)23-20(27)24-16-7-4-14(5-8-16)19(26)25-10-2-3-11-25/h4-9,12-13H,2-3,10-11H2,1H3,(H2,23,24,27) |
| InChIKey | XNNKKVKOLJJGOC-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.40 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |