C21H33N5O2 — CID 86796846
1-[4-(4-methylpiperazin-1-yl)butan-2-yl]-3-[4-(pyrrolidine-1-carbonyl)phenyl]urea (PubChem CID 86796846) has the molecular formula C21H33N5O2 and a molecular weight of 387.53 g/mol. Its IUPAC name is 1-[4-(4-methylpiperazin-1-yl)butan-2-yl]-3-[4-(pyrrolidine-1-carbonyl)phenyl]urea.
| Compound Name | 1-[4-(4-methylpiperazin-1-yl)butan-2-yl]-3-[4-(pyrrolidine-1-carbonyl)phenyl]urea |
|---|---|
| PubChem CID | 86796846 |
| Molecular Formula | C21H33N5O2 |
| Molecular Weight | 387.53 g/mol |
| Exact Mass | 387.26 |
| IUPAC Name | 1-[4-(4-methylpiperazin-1-yl)butan-2-yl]-3-[4-(pyrrolidine-1-carbonyl)phenyl]urea |
| SMILES | CC(CCN1CCN(C)CC1)NC(=O)Nc1ccc(C(=O)N2CCCC2)cc1 |
| InChI | InChI=1S/C21H33N5O2/c1-17(9-12-25-15-13-24(2)14-16-25)22-21(28)23-19-7-5-18(6-8-19)20(27)26-10-3-4-11-26/h5-8,17H,3-4,9-16H2,1-2H3,(H2,22,23,28) |
| InChIKey | WSTIPUMTYFOLAR-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 67.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.53 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |