C13H18F2N2O — CID 51650211
1-[(1R)-1-(3,4-difluorophenyl)ethyl]-3-(2-methylpropyl)urea (PubChem CID 51650211) has the molecular formula C13H18F2N2O and a molecular weight of 256.30 g/mol. Its IUPAC name is 1-[(1R)-1-(3,4-difluorophenyl)ethyl]-3-(2-methylpropyl)urea.
| Compound Name | 1-[(1R)-1-(3,4-difluorophenyl)ethyl]-3-(2-methylpropyl)urea |
|---|---|
| PubChem CID | 51650211 |
| Molecular Formula | C13H18F2N2O |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.14 |
| IUPAC Name | 1-[(1R)-1-(3,4-difluorophenyl)ethyl]-3-(2-methylpropyl)urea |
| SMILES | CC(C)CNC(=O)N[C@H](C)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C13H18F2N2O/c1-8(2)7-16-13(18)17-9(3)10-4-5-11(14)12(15)6-10/h4-6,8-9H,7H2,1-3H3,(H2,16,17,18)/t9-/m1/s1 |
| InChIKey | HHZJDDAILCHBMF-SECBINFHSA-N |
| XLogP | 2.98 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |