C19H22F2N2O2 — CID 111453817
1-[1-(3,4-difluorophenyl)ethyl]-3-(4-hydroxy-1-phenylbutyl)urea (PubChem CID 111453817) has the molecular formula C19H22F2N2O2 and a molecular weight of 348.39 g/mol. Its IUPAC name is 1-[1-(3,4-difluorophenyl)ethyl]-3-(4-hydroxy-1-phenylbutyl)urea.
| Compound Name | 1-[1-(3,4-difluorophenyl)ethyl]-3-(4-hydroxy-1-phenylbutyl)urea |
|---|---|
| PubChem CID | 111453817 |
| Molecular Formula | C19H22F2N2O2 |
| Molecular Weight | 348.39 g/mol |
| Exact Mass | 348.16 |
| IUPAC Name | 1-[1-(3,4-difluorophenyl)ethyl]-3-(4-hydroxy-1-phenylbutyl)urea |
| SMILES | CC(NC(=O)NC(CCCO)c1ccccc1)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C19H22F2N2O2/c1-13(15-9-10-16(20)17(21)12-15)22-19(25)23-18(8-5-11-24)14-6-3-2-4-7-14/h2-4,6-7,9-10,12-13,18,24H,5,8,11H2,1H3,(H2,22,23,25) |
| InChIKey | PZRZKRRPUBLQKW-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.39 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |