C19H21F2NO — CID 31195240
(2S)-N-[(1S)-1-(3,4-difluorophenyl)ethyl]-2-phenylpentanamide (PubChem CID 31195240) has the molecular formula C19H21F2NO and a molecular weight of 317.38 g/mol. Its IUPAC name is (2S)-N-[(1S)-1-(3,4-difluorophenyl)ethyl]-2-phenylpentanamide.
| Compound Name | (2S)-N-[(1S)-1-(3,4-difluorophenyl)ethyl]-2-phenylpentanamide |
|---|---|
| PubChem CID | 31195240 |
| Molecular Formula | C19H21F2NO |
| Molecular Weight | 317.38 g/mol |
| Exact Mass | 317.16 |
| IUPAC Name | (2S)-N-[(1S)-1-(3,4-difluorophenyl)ethyl]-2-phenylpentanamide |
| SMILES | CCC[C@H](C(=O)N[C@@H](C)c1ccc(F)c(F)c1)c1ccccc1 |
| InChI | InChI=1S/C19H21F2NO/c1-3-7-16(14-8-5-4-6-9-14)19(23)22-13(2)15-10-11-17(20)18(21)12-15/h4-6,8-13,16H,3,7H2,1-2H3,(H,22,23)/t13-,16-/m0/s1 |
| InChIKey | UZLLGPYJRNKBTF-BBRMVZONSA-N |
| XLogP | 4.73 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.38 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |