C11H12Cl2FNO2 — CID 7039743
ethyl N-[(1S)-2,2-dichloro-1-(4-fluorophenyl)ethyl]carbamate (PubChem CID 7039743) has the molecular formula C11H12Cl2FNO2 and a molecular weight of 280.13 g/mol. Its IUPAC name is ethyl N-[(1S)-2,2-dichloro-1-(4-fluorophenyl)ethyl]carbamate.
| Compound Name | ethyl N-[(1S)-2,2-dichloro-1-(4-fluorophenyl)ethyl]carbamate |
|---|---|
| PubChem CID | 7039743 |
| Molecular Formula | C11H12Cl2FNO2 |
| Molecular Weight | 280.13 g/mol |
| Exact Mass | 279.02 |
| IUPAC Name | ethyl N-[(1S)-2,2-dichloro-1-(4-fluorophenyl)ethyl]carbamate |
| SMILES | CCOC(=O)N[C@@H](c1ccc(F)cc1)C(Cl)Cl |
| InChI | InChI=1S/C11H12Cl2FNO2/c1-2-17-11(16)15-9(10(12)13)7-3-5-8(14)6-4-7/h3-6,9-10H,2H2,1H3,(H,15,16)/t9-/m0/s1 |
| InChIKey | IEUTXQTUSDFCLZ-VIFPVBQESA-N |
| XLogP | 3.42 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.13 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|