C18H18FNO4 — CID 163362371
ethyl (2S,3S)-3-benzamido-3-(4-fluorophenyl)-2-hydroxypropanoate (PubChem CID 163362371) has the molecular formula C18H18FNO4 and a molecular weight of 331.34 g/mol. Its IUPAC name is ethyl (2S,3S)-3-benzamido-3-(4-fluorophenyl)-2-hydroxypropanoate.
| Compound Name | ethyl (2S,3S)-3-benzamido-3-(4-fluorophenyl)-2-hydroxypropanoate |
|---|---|
| PubChem CID | 163362371 |
| Molecular Formula | C18H18FNO4 |
| Molecular Weight | 331.34 g/mol |
| Exact Mass | 331.12 |
| IUPAC Name | ethyl (2S,3S)-3-benzamido-3-(4-fluorophenyl)-2-hydroxypropanoate |
| SMILES | CCOC(=O)[C@@H](O)[C@@H](NC(=O)c1ccccc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C18H18FNO4/c1-2-24-18(23)16(21)15(12-8-10-14(19)11-9-12)20-17(22)13-6-4-3-5-7-13/h3-11,15-16,21H,2H2,1H3,(H,20,22)/t15-,16-/m0/s1 |
| InChIKey | VXJFGKOMBJNWRZ-HOTGVXAUSA-N |
| XLogP | 2.22 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.34 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |