C22H27NO3 — CID 102462810
ethyl (2R)-2-[(2R)-2-benzamido-2-phenylethyl]pentanoate (PubChem CID 102462810) has the molecular formula C22H27NO3 and a molecular weight of 353.46 g/mol. Its IUPAC name is ethyl (2R)-2-[(2R)-2-benzamido-2-phenylethyl]pentanoate.
| Compound Name | ethyl (2R)-2-[(2R)-2-benzamido-2-phenylethyl]pentanoate |
|---|---|
| PubChem CID | 102462810 |
| Molecular Formula | C22H27NO3 |
| Molecular Weight | 353.46 g/mol |
| Exact Mass | 353.20 |
| IUPAC Name | ethyl (2R)-2-[(2R)-2-benzamido-2-phenylethyl]pentanoate |
| SMILES | CCC[C@H](C[C@@H](NC(=O)c1ccccc1)c1ccccc1)C(=O)OCC |
| InChI | InChI=1S/C22H27NO3/c1-3-11-19(22(25)26-4-2)16-20(17-12-7-5-8-13-17)23-21(24)18-14-9-6-10-15-18/h5-10,12-15,19-20H,3-4,11,16H2,1-2H3,(H,23,24)/t19-,20-/m1/s1 |
| InChIKey | OCGMEZWYTZMHRJ-WOJBJXKFSA-N |
| XLogP | 4.53 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.46 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |