C11H12FNO3S — CID 2635095
ethyl N-[2-(4-fluorophenyl)sulfanylacetyl]carbamate (PubChem CID 2635095) has the molecular formula C11H12FNO3S and a molecular weight of 257.29 g/mol. Its IUPAC name is ethyl N-[2-(4-fluorophenyl)sulfanylacetyl]carbamate.
| Compound Name | ethyl N-[2-(4-fluorophenyl)sulfanylacetyl]carbamate |
|---|---|
| PubChem CID | 2635095 |
| Molecular Formula | C11H12FNO3S |
| Molecular Weight | 257.29 g/mol |
| Exact Mass | 257.05 |
| IUPAC Name | ethyl N-[2-(4-fluorophenyl)sulfanylacetyl]carbamate |
| SMILES | CCOC(=O)NC(=O)CSc1ccc(F)cc1 |
| InChI | InChI=1S/C11H12FNO3S/c1-2-16-11(15)13-10(14)7-17-9-5-3-8(12)4-6-9/h3-6H,2,7H2,1H3,(H,13,14,15) |
| InChIKey | GMPGZYYNRHZWJC-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.29 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |