C17H17FN2O4S2 — CID 7546528
ethyl N-[2-[3-(4-fluorophenyl)sulfanylpropanoylamino]thiophene-3-carbonyl]carbamate (PubChem CID 7546528) has the molecular formula C17H17FN2O4S2 and a molecular weight of 396.47 g/mol. Its IUPAC name is ethyl N-[2-[3-(4-fluorophenyl)sulfanylpropanoylamino]thiophene-3-carbonyl]carbamate.
| Compound Name | ethyl N-[2-[3-(4-fluorophenyl)sulfanylpropanoylamino]thiophene-3-carbonyl]carbamate |
|---|---|
| PubChem CID | 7546528 |
| Molecular Formula | C17H17FN2O4S2 |
| Molecular Weight | 396.47 g/mol |
| Exact Mass | 396.06 |
| IUPAC Name | ethyl N-[2-[3-(4-fluorophenyl)sulfanylpropanoylamino]thiophene-3-carbonyl]carbamate |
| SMILES | CCOC(=O)NC(=O)c1ccsc1NC(=O)CCSc1ccc(F)cc1 |
| InChI | InChI=1S/C17H17FN2O4S2/c1-2-24-17(23)20-15(22)13-7-9-26-16(13)19-14(21)8-10-25-12-5-3-11(18)4-6-12/h3-7,9H,2,8,10H2,1H3,(H,19,21)(H,20,22,23) |
| InChIKey | QTKLEEKSJKSLTQ-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.47 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |