C17H18N2O4S — CID 7167179
ethyl N-[2-(3-phenylpropanoylamino)thiophene-3-carbonyl]carbamate (PubChem CID 7167179) has the molecular formula C17H18N2O4S and a molecular weight of 346.41 g/mol. Its IUPAC name is ethyl N-[2-(3-phenylpropanoylamino)thiophene-3-carbonyl]carbamate.
| Compound Name | ethyl N-[2-(3-phenylpropanoylamino)thiophene-3-carbonyl]carbamate |
|---|---|
| PubChem CID | 7167179 |
| Molecular Formula | C17H18N2O4S |
| Molecular Weight | 346.41 g/mol |
| Exact Mass | 346.10 |
| IUPAC Name | ethyl N-[2-(3-phenylpropanoylamino)thiophene-3-carbonyl]carbamate |
| SMILES | CCOC(=O)NC(=O)c1ccsc1NC(=O)CCc1ccccc1 |
| InChI | InChI=1S/C17H18N2O4S/c1-2-23-17(22)19-15(21)13-10-11-24-16(13)18-14(20)9-8-12-6-4-3-5-7-12/h3-7,10-11H,2,8-9H2,1H3,(H,18,20)(H,19,21,22) |
| InChIKey | XGDIQUFGUJVTLN-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.41 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |