C13H11BrN2O4S2 — CID 7167142
ethyl N-[2-[(5-bromothiophene-2-carbonyl)amino]thiophene-3-carbonyl]carbamate (PubChem CID 7167142) has the molecular formula C13H11BrN2O4S2 and a molecular weight of 403.28 g/mol. Its IUPAC name is ethyl N-[2-[(5-bromothiophene-2-carbonyl)amino]thiophene-3-carbonyl]carbamate.
| Compound Name | ethyl N-[2-[(5-bromothiophene-2-carbonyl)amino]thiophene-3-carbonyl]carbamate |
|---|---|
| PubChem CID | 7167142 |
| Molecular Formula | C13H11BrN2O4S2 |
| Molecular Weight | 403.28 g/mol |
| Exact Mass | 401.93 |
| IUPAC Name | ethyl N-[2-[(5-bromothiophene-2-carbonyl)amino]thiophene-3-carbonyl]carbamate |
| SMILES | CCOC(=O)NC(=O)c1ccsc1NC(=O)c1ccc(Br)s1 |
| InChI | InChI=1S/C13H11BrN2O4S2/c1-2-20-13(19)16-10(17)7-5-6-21-12(7)15-11(18)8-3-4-9(14)22-8/h3-6H,2H2,1H3,(H,15,18)(H,16,17,19) |
| InChIKey | POAGDTPAPUZTFI-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.28 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |