C11H8BrNO3S2 — CID 7166879
methyl 2-[(5-bromothiophene-2-carbonyl)amino]thiophene-3-carboxylate (PubChem CID 7166879) has the molecular formula C11H8BrNO3S2 and a molecular weight of 346.23 g/mol. Its IUPAC name is methyl 2-[(5-bromothiophene-2-carbonyl)amino]thiophene-3-carboxylate.
| Compound Name | methyl 2-[(5-bromothiophene-2-carbonyl)amino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 7166879 |
| Molecular Formula | C11H8BrNO3S2 |
| Molecular Weight | 346.23 g/mol |
| Exact Mass | 344.91 |
| IUPAC Name | methyl 2-[(5-bromothiophene-2-carbonyl)amino]thiophene-3-carboxylate |
| SMILES | COC(=O)c1ccsc1NC(=O)c1ccc(Br)s1 |
| InChI | InChI=1S/C11H8BrNO3S2/c1-16-11(15)6-4-5-17-10(6)13-9(14)7-2-3-8(12)18-7/h2-5H,1H3,(H,13,14) |
| InChIKey | GHOKTNQZRJKYAL-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.23 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |