C10H7BrN2O2S2 — CID 6710572
2-[(5-bromothiophene-2-carbonyl)amino]thiophene-3-carboxamide (PubChem CID 6710572) has the molecular formula C10H7BrN2O2S2 and a molecular weight of 331.22 g/mol. Its IUPAC name is 2-[(5-bromothiophene-2-carbonyl)amino]thiophene-3-carboxamide.
| Compound Name | 2-[(5-bromothiophene-2-carbonyl)amino]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 6710572 |
| Molecular Formula | C10H7BrN2O2S2 |
| Molecular Weight | 331.22 g/mol |
| Exact Mass | 329.91 |
| IUPAC Name | 2-[(5-bromothiophene-2-carbonyl)amino]thiophene-3-carboxamide |
| SMILES | NC(=O)c1ccsc1NC(=O)c1ccc(Br)s1 |
| InChI | InChI=1S/C10H7BrN2O2S2/c11-7-2-1-6(17-7)9(15)13-10-5(8(12)14)3-4-16-10/h1-4H,(H2,12,14)(H,13,15) |
| InChIKey | OMSJCLXDTDSCNU-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.22 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |