C12H9BrN2O2S2 — CID 154770259
2-[3-(5-bromothiophen-2-yl)prop-2-enoylamino]thiophene-3-carboxamide (PubChem CID 154770259) has the molecular formula C12H9BrN2O2S2 and a molecular weight of 357.25 g/mol. Its IUPAC name is 2-[3-(5-bromothiophen-2-yl)prop-2-enoylamino]thiophene-3-carboxamide.
| Compound Name | 2-[3-(5-bromothiophen-2-yl)prop-2-enoylamino]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 154770259 |
| Molecular Formula | C12H9BrN2O2S2 |
| Molecular Weight | 357.25 g/mol |
| Exact Mass | 355.93 |
| IUPAC Name | 2-[3-(5-bromothiophen-2-yl)prop-2-enoylamino]thiophene-3-carboxamide |
| SMILES | NC(=O)c1ccsc1NC(=O)C=Cc1ccc(Br)s1 |
| InChI | InChI=1S/C12H9BrN2O2S2/c13-9-3-1-7(19-9)2-4-10(16)15-12-8(11(14)17)5-6-18-12/h1-6H,(H2,14,17)(H,15,16) |
| InChIKey | TXKGPOQXNKDXMF-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.25 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|