C13H14BrN3OS2 — CID 26197120
(E)-3-(5-bromothiophen-2-yl)-N-(5-butyl-1,3,4-thiadiazol-2-yl)prop-2-enamide (PubChem CID 26197120) has the molecular formula C13H14BrN3OS2 and a molecular weight of 372.31 g/mol. Its IUPAC name is (E)-3-(5-bromothiophen-2-yl)-N-(5-butyl-1,3,4-thiadiazol-2-yl)prop-2-enamide.
| Compound Name | (E)-3-(5-bromothiophen-2-yl)-N-(5-butyl-1,3,4-thiadiazol-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 26197120 |
| Molecular Formula | C13H14BrN3OS2 |
| Molecular Weight | 372.31 g/mol |
| Exact Mass | 370.98 |
| IUPAC Name | (E)-3-(5-bromothiophen-2-yl)-N-(5-butyl-1,3,4-thiadiazol-2-yl)prop-2-enamide |
| SMILES | CCCCc1nnc(NC(=O)/C=C/c2ccc(Br)s2)s1 |
| InChI | InChI=1S/C13H14BrN3OS2/c1-2-3-4-12-16-17-13(20-12)15-11(18)8-6-9-5-7-10(14)19-9/h5-8H,2-4H2,1H3,(H,15,17,18)/b8-6+ |
| InChIKey | FRIUGOJLIBKONH-SOFGYWHQSA-N |
| XLogP | 4.36 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.31 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|