C12H14N4OS2 — CID 47141240
(E)-3-(2-methyl-1,3-thiazol-4-yl)-N-(5-propyl-1,3,4-thiadiazol-2-yl)prop-2-enamide (PubChem CID 47141240) has the molecular formula C12H14N4OS2 and a molecular weight of 294.41 g/mol. Its IUPAC name is (E)-3-(2-methyl-1,3-thiazol-4-yl)-N-(5-propyl-1,3,4-thiadiazol-2-yl)prop-2-enamide.
| Compound Name | (E)-3-(2-methyl-1,3-thiazol-4-yl)-N-(5-propyl-1,3,4-thiadiazol-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 47141240 |
| Molecular Formula | C12H14N4OS2 |
| Molecular Weight | 294.41 g/mol |
| Exact Mass | 294.06 |
| IUPAC Name | (E)-3-(2-methyl-1,3-thiazol-4-yl)-N-(5-propyl-1,3,4-thiadiazol-2-yl)prop-2-enamide |
| SMILES | CCCc1nnc(NC(=O)/C=C/c2csc(C)n2)s1 |
| InChI | InChI=1S/C12H14N4OS2/c1-3-4-11-15-16-12(19-11)14-10(17)6-5-9-7-18-8(2)13-9/h5-7H,3-4H2,1-2H3,(H,14,16,17)/b6-5+ |
| InChIKey | KIPQATSHQDLZSV-AATRIKPKSA-N |
| XLogP | 2.91 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.41 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|