C10H14N4O2S — CID 6435707
(E)-N'-(5-butyl-1,3,4-thiadiazol-2-yl)but-2-enediamide (PubChem CID 6435707) has the molecular formula C10H14N4O2S and a molecular weight of 254.31 g/mol. Its IUPAC name is (E)-N'-(5-butyl-1,3,4-thiadiazol-2-yl)but-2-enediamide.
| Compound Name | (E)-N'-(5-butyl-1,3,4-thiadiazol-2-yl)but-2-enediamide |
|---|---|
| PubChem CID | 6435707 |
| Molecular Formula | C10H14N4O2S |
| Molecular Weight | 254.31 g/mol |
| Exact Mass | 254.08 |
| IUPAC Name | (E)-N'-(5-butyl-1,3,4-thiadiazol-2-yl)but-2-enediamide |
| SMILES | CCCCc1nnc(NC(=O)/C=C/C(N)=O)s1 |
| InChI | InChI=1S/C10H14N4O2S/c1-2-3-4-9-13-14-10(17-9)12-8(16)6-5-7(11)15/h5-6H,2-4H2,1H3,(H2,11,15)(H,12,14,16)/b6-5+ |
| InChIKey | HECVEDZOZQJAPQ-AATRIKPKSA-N |
| XLogP | 0.86 |
| TPSA | 97.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.31 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|