C13H23N3O2S — CID 2207802
pentyl N-(5-pentyl-1,3,4-thiadiazol-2-yl)carbamate (PubChem CID 2207802) has the molecular formula C13H23N3O2S and a molecular weight of 285.41 g/mol. Its IUPAC name is pentyl N-(5-pentyl-1,3,4-thiadiazol-2-yl)carbamate.
| Compound Name | pentyl N-(5-pentyl-1,3,4-thiadiazol-2-yl)carbamate |
|---|---|
| PubChem CID | 2207802 |
| Molecular Formula | C13H23N3O2S |
| Molecular Weight | 285.41 g/mol |
| Exact Mass | 285.15 |
| IUPAC Name | pentyl N-(5-pentyl-1,3,4-thiadiazol-2-yl)carbamate |
| SMILES | CCCCCOC(=O)Nc1nnc(CCCCC)s1 |
| InChI | InChI=1S/C13H23N3O2S/c1-3-5-7-9-11-15-16-12(19-11)14-13(17)18-10-8-6-4-2/h3-10H2,1-2H3,(H,14,16,17) |
| InChIKey | MRNPJDJHYLFSFP-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.41 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|