C15H26N4O3S — CID 47082039
tert-butyl N-[(2R)-1-oxo-1-[(5-pentyl-1,3,4-thiadiazol-2-yl)amino]propan-2-yl]carbamate (PubChem CID 47082039) has the molecular formula C15H26N4O3S and a molecular weight of 342.47 g/mol. Its IUPAC name is tert-butyl N-[(2R)-1-oxo-1-[(5-pentyl-1,3,4-thiadiazol-2-yl)amino]propan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2R)-1-oxo-1-[(5-pentyl-1,3,4-thiadiazol-2-yl)amino]propan-2-yl]carbamate |
|---|---|
| PubChem CID | 47082039 |
| Molecular Formula | C15H26N4O3S |
| Molecular Weight | 342.47 g/mol |
| Exact Mass | 342.17 |
| IUPAC Name | tert-butyl N-[(2R)-1-oxo-1-[(5-pentyl-1,3,4-thiadiazol-2-yl)amino]propan-2-yl]carbamate |
| SMILES | CCCCCc1nnc(NC(=O)[C@@H](C)NC(=O)OC(C)(C)C)s1 |
| InChI | InChI=1S/C15H26N4O3S/c1-6-7-8-9-11-18-19-13(23-11)17-12(20)10(2)16-14(21)22-15(3,4)5/h10H,6-9H2,1-5H3,(H,16,21)(H,17,19,20)/t10-/m1/s1 |
| InChIKey | HGTBMWYZGDGLMO-SNVBAGLBSA-N |
| XLogP | 3.12 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.47 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|