C15H12N4OS2 — CID 16582919
(E)-3-(2-methyl-1,3-thiazol-4-yl)-N-(4-pyridin-2-yl-1,3-thiazol-2-yl)prop-2-enamide (PubChem CID 16582919) has the molecular formula C15H12N4OS2 and a molecular weight of 328.42 g/mol. Its IUPAC name is (E)-3-(2-methyl-1,3-thiazol-4-yl)-N-(4-pyridin-2-yl-1,3-thiazol-2-yl)prop-2-enamide.
| Compound Name | (E)-3-(2-methyl-1,3-thiazol-4-yl)-N-(4-pyridin-2-yl-1,3-thiazol-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 16582919 |
| Molecular Formula | C15H12N4OS2 |
| Molecular Weight | 328.42 g/mol |
| Exact Mass | 328.05 |
| IUPAC Name | (E)-3-(2-methyl-1,3-thiazol-4-yl)-N-(4-pyridin-2-yl-1,3-thiazol-2-yl)prop-2-enamide |
| SMILES | Cc1nc(/C=C/C(=O)Nc2nc(-c3ccccn3)cs2)cs1 |
| InChI | InChI=1S/C15H12N4OS2/c1-10-17-11(8-21-10)5-6-14(20)19-15-18-13(9-22-15)12-4-2-3-7-16-12/h2-9H,1H3,(H,18,19,20)/b6-5+ |
| InChIKey | FKZPZLZZEXHHLQ-AATRIKPKSA-N |
| XLogP | 3.62 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.42 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|