C16H13N3OS2 — CID 41191672
(E)-3-(2-methyl-1,3-thiazol-4-yl)-N-[4-(1,3-thiazol-2-yl)phenyl]prop-2-enamide (PubChem CID 41191672) has the molecular formula C16H13N3OS2 and a molecular weight of 327.43 g/mol. Its IUPAC name is (E)-3-(2-methyl-1,3-thiazol-4-yl)-N-[4-(1,3-thiazol-2-yl)phenyl]prop-2-enamide.
| Compound Name | (E)-3-(2-methyl-1,3-thiazol-4-yl)-N-[4-(1,3-thiazol-2-yl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 41191672 |
| Molecular Formula | C16H13N3OS2 |
| Molecular Weight | 327.43 g/mol |
| Exact Mass | 327.05 |
| IUPAC Name | (E)-3-(2-methyl-1,3-thiazol-4-yl)-N-[4-(1,3-thiazol-2-yl)phenyl]prop-2-enamide |
| SMILES | Cc1nc(/C=C/C(=O)Nc2ccc(-c3nccs3)cc2)cs1 |
| InChI | InChI=1S/C16H13N3OS2/c1-11-18-14(10-22-11)6-7-15(20)19-13-4-2-12(3-5-13)16-17-8-9-21-16/h2-10H,1H3,(H,19,20)/b7-6+ |
| InChIKey | ZHZZSASYTCJAOR-VOTSOKGWSA-N |
| XLogP | 4.23 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.43 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|