C13H11N3O3S — CID 76986589
5-[3-(2-methyl-1,3-thiazol-4-yl)prop-2-enoylamino]pyridine-3-carboxylic acid (PubChem CID 76986589) has the molecular formula C13H11N3O3S and a molecular weight of 289.32 g/mol. Its IUPAC name is 5-[3-(2-methyl-1,3-thiazol-4-yl)prop-2-enoylamino]pyridine-3-carboxylic acid.
| Compound Name | 5-[3-(2-methyl-1,3-thiazol-4-yl)prop-2-enoylamino]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 76986589 |
| Molecular Formula | C13H11N3O3S |
| Molecular Weight | 289.32 g/mol |
| Exact Mass | 289.05 |
| IUPAC Name | 5-[3-(2-methyl-1,3-thiazol-4-yl)prop-2-enoylamino]pyridine-3-carboxylic acid |
| SMILES | Cc1nc(C=CC(=O)Nc2cncc(C(=O)O)c2)cs1 |
| InChI | InChI=1S/C13H11N3O3S/c1-8-15-10(7-20-8)2-3-12(17)16-11-4-9(13(18)19)5-14-6-11/h2-7H,1H3,(H,16,17)(H,18,19) |
| InChIKey | XTRBQXUQUIXBGA-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 92.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.32 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|