C15H10F6N2OS — CID 25470231
(E)-N-[3,5-bis(trifluoromethyl)phenyl]-3-(2-methyl-1,3-thiazol-4-yl)prop-2-enamide (PubChem CID 25470231) has the molecular formula C15H10F6N2OS and a molecular weight of 380.31 g/mol. Its IUPAC name is (E)-N-[3,5-bis(trifluoromethyl)phenyl]-3-(2-methyl-1,3-thiazol-4-yl)prop-2-enamide.
| Compound Name | (E)-N-[3,5-bis(trifluoromethyl)phenyl]-3-(2-methyl-1,3-thiazol-4-yl)prop-2-enamide |
|---|---|
| PubChem CID | 25470231 |
| Molecular Formula | C15H10F6N2OS |
| Molecular Weight | 380.31 g/mol |
| Exact Mass | 380.04 |
| IUPAC Name | (E)-N-[3,5-bis(trifluoromethyl)phenyl]-3-(2-methyl-1,3-thiazol-4-yl)prop-2-enamide |
| SMILES | Cc1nc(/C=C/C(=O)Nc2cc(C(F)(F)F)cc(C(F)(F)F)c2)cs1 |
| InChI | InChI=1S/C15H10F6N2OS/c1-8-22-11(7-25-8)2-3-13(24)23-12-5-9(14(16,17)18)4-10(6-12)15(19,20)21/h2-7H,1H3,(H,23,24)/b3-2+ |
| InChIKey | AJCUITWZIBJGRB-NSCUHMNNSA-N |
| XLogP | 5.14 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.31 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|