C18H13F6NO — CID 7926539
(E)-N-[3,5-bis(trifluoromethyl)phenyl]-3-(4-methylphenyl)prop-2-enamide (PubChem CID 7926539) has the molecular formula C18H13F6NO and a molecular weight of 373.30 g/mol. Its IUPAC name is (E)-N-[3,5-bis(trifluoromethyl)phenyl]-3-(4-methylphenyl)prop-2-enamide.
| Compound Name | (E)-N-[3,5-bis(trifluoromethyl)phenyl]-3-(4-methylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 7926539 |
| Molecular Formula | C18H13F6NO |
| Molecular Weight | 373.30 g/mol |
| Exact Mass | 373.09 |
| IUPAC Name | (E)-N-[3,5-bis(trifluoromethyl)phenyl]-3-(4-methylphenyl)prop-2-enamide |
| SMILES | Cc1ccc(/C=C/C(=O)Nc2cc(C(F)(F)F)cc(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C18H13F6NO/c1-11-2-4-12(5-3-11)6-7-16(26)25-15-9-13(17(19,20)21)8-14(10-15)18(22,23)24/h2-10H,1H3,(H,25,26)/b7-6+ |
| InChIKey | MHADQKCSFHGSOO-VOTSOKGWSA-N |
| XLogP | 5.68 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.30 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|