C17H12F6N2O2 — CID 71888429
3-[3,5-bis(trifluoromethyl)phenyl]-N-(1-methyl-6-oxo-3-pyridinyl)prop-2-enamide (PubChem CID 71888429) has the molecular formula C17H12F6N2O2 and a molecular weight of 390.28 g/mol. Its IUPAC name is 3-[3,5-bis(trifluoromethyl)phenyl]-N-(1-methyl-6-oxo-3-pyridinyl)prop-2-enamide.
| Compound Name | 3-[3,5-bis(trifluoromethyl)phenyl]-N-(1-methyl-6-oxo-3-pyridinyl)prop-2-enamide |
|---|---|
| PubChem CID | 71888429 |
| Molecular Formula | C17H12F6N2O2 |
| Molecular Weight | 390.28 g/mol |
| Exact Mass | 390.08 |
| IUPAC Name | 3-[3,5-bis(trifluoromethyl)phenyl]-N-(1-methyl-6-oxo-3-pyridinyl)prop-2-enamide |
| SMILES | Cn1cc(NC(=O)C=Cc2cc(C(F)(F)F)cc(C(F)(F)F)c2)ccc1=O |
| InChI | InChI=1S/C17H12F6N2O2/c1-25-9-13(3-5-15(25)27)24-14(26)4-2-10-6-11(16(18,19)20)8-12(7-10)17(21,22)23/h2-9H,1H3,(H,24,26) |
| InChIKey | URXAKJBWQXMWJB-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.28 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|