C16H13F6N3O — CID 75364057
(E)-3-[3,5-bis(trifluoromethyl)phenyl]-N-[(1-methylpyrazol-4-yl)methyl]prop-2-enamide (PubChem CID 75364057) has the molecular formula C16H13F6N3O and a molecular weight of 377.29 g/mol. Its IUPAC name is (E)-3-[3,5-bis(trifluoromethyl)phenyl]-N-[(1-methylpyrazol-4-yl)methyl]prop-2-enamide.
| Compound Name | (E)-3-[3,5-bis(trifluoromethyl)phenyl]-N-[(1-methylpyrazol-4-yl)methyl]prop-2-enamide |
|---|---|
| PubChem CID | 75364057 |
| Molecular Formula | C16H13F6N3O |
| Molecular Weight | 377.29 g/mol |
| Exact Mass | 377.10 |
| IUPAC Name | (E)-3-[3,5-bis(trifluoromethyl)phenyl]-N-[(1-methylpyrazol-4-yl)methyl]prop-2-enamide |
| SMILES | Cn1cc(CNC(=O)/C=C/c2cc(C(F)(F)F)cc(C(F)(F)F)c2)cn1 |
| InChI | InChI=1S/C16H13F6N3O/c1-25-9-11(8-24-25)7-23-14(26)3-2-10-4-12(15(17,18)19)6-13(5-10)16(20,21)22/h2-6,8-9H,7H2,1H3,(H,23,26)/b3-2+ |
| InChIKey | MMOVWTCSORPWGU-NSCUHMNNSA-N |
| XLogP | 3.79 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.29 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|