C17H12F3NO3 — CID 13228845
4-[[(E)-3-[3-(trifluoromethyl)phenyl]prop-2-enoyl]amino]benzoic acid (PubChem CID 13228845) has the molecular formula C17H12F3NO3 and a molecular weight of 335.28 g/mol. Its IUPAC name is 4-[[(E)-3-[3-(trifluoromethyl)phenyl]prop-2-enoyl]amino]benzoic acid.
| Compound Name | 4-[[(E)-3-[3-(trifluoromethyl)phenyl]prop-2-enoyl]amino]benzoic acid |
|---|---|
| PubChem CID | 13228845 |
| Molecular Formula | C17H12F3NO3 |
| Molecular Weight | 335.28 g/mol |
| Exact Mass | 335.08 |
| IUPAC Name | 4-[[(E)-3-[3-(trifluoromethyl)phenyl]prop-2-enoyl]amino]benzoic acid |
| SMILES | O=C(/C=C/c1cccc(C(F)(F)F)c1)Nc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C17H12F3NO3/c18-17(19,20)13-3-1-2-11(10-13)4-9-15(22)21-14-7-5-12(6-8-14)16(23)24/h1-10H,(H,21,22)(H,23,24)/b9-4+ |
| InChIKey | SXNAEXDONWECAN-RUDMXATFSA-N |
| XLogP | 4.06 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.28 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|