C17H11F3N2O — CID 3903026
N-(4-cyanophenyl)-3-[3-(trifluoromethyl)phenyl]prop-2-enamide (PubChem CID 3903026) has the molecular formula C17H11F3N2O and a molecular weight of 316.28 g/mol. Its IUPAC name is N-(4-cyanophenyl)-3-[3-(trifluoromethyl)phenyl]prop-2-enamide.
| Compound Name | N-(4-cyanophenyl)-3-[3-(trifluoromethyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 3903026 |
| Molecular Formula | C17H11F3N2O |
| Molecular Weight | 316.28 g/mol |
| Exact Mass | 316.08 |
| IUPAC Name | N-(4-cyanophenyl)-3-[3-(trifluoromethyl)phenyl]prop-2-enamide |
| SMILES | N#Cc1ccc(NC(=O)C=Cc2cccc(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C17H11F3N2O/c18-17(19,20)14-3-1-2-12(10-14)6-9-16(23)22-15-7-4-13(11-21)5-8-15/h1-10H,(H,22,23) |
| InChIKey | INAHZUGWSLBMDP-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.28 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|