C19H20F3N3O3S — CID 55970240
tert-butyl N-[2-[[(E)-3-(2-methyl-1,3-thiazol-4-yl)prop-2-enoyl]amino]-4-(trifluoromethyl)phenyl]carbamate (PubChem CID 55970240) has the molecular formula C19H20F3N3O3S and a molecular weight of 427.45 g/mol. Its IUPAC name is tert-butyl N-[2-[[(E)-3-(2-methyl-1,3-thiazol-4-yl)prop-2-enoyl]amino]-4-(trifluoromethyl)phenyl]carbamate.
| Compound Name | tert-butyl N-[2-[[(E)-3-(2-methyl-1,3-thiazol-4-yl)prop-2-enoyl]amino]-4-(trifluoromethyl)phenyl]carbamate |
|---|---|
| PubChem CID | 55970240 |
| Molecular Formula | C19H20F3N3O3S |
| Molecular Weight | 427.45 g/mol |
| Exact Mass | 427.12 |
| IUPAC Name | tert-butyl N-[2-[[(E)-3-(2-methyl-1,3-thiazol-4-yl)prop-2-enoyl]amino]-4-(trifluoromethyl)phenyl]carbamate |
| SMILES | Cc1nc(/C=C/C(=O)Nc2cc(C(F)(F)F)ccc2NC(=O)OC(C)(C)C)cs1 |
| InChI | InChI=1S/C19H20F3N3O3S/c1-11-23-13(10-29-11)6-8-16(26)24-15-9-12(19(20,21)22)5-7-14(15)25-17(27)28-18(2,3)4/h5-10H,1-4H3,(H,24,26)(H,25,27)/b8-6+ |
| InChIKey | MVFDCKVMZHIPJH-SOFGYWHQSA-N |
| XLogP | 5.47 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.45 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|