C11H11F3N2O3S — CID 79796159
3,3,3-trifluoro-2-methyl-2-[3-(2-methyl-1,3-thiazol-4-yl)prop-2-enoylamino]propanoic acid (PubChem CID 79796159) has the molecular formula C11H11F3N2O3S and a molecular weight of 308.28 g/mol. Its IUPAC name is 3,3,3-trifluoro-2-methyl-2-[3-(2-methyl-1,3-thiazol-4-yl)prop-2-enoylamino]propanoic acid.
| Compound Name | 3,3,3-trifluoro-2-methyl-2-[3-(2-methyl-1,3-thiazol-4-yl)prop-2-enoylamino]propanoic acid |
|---|---|
| PubChem CID | 79796159 |
| Molecular Formula | C11H11F3N2O3S |
| Molecular Weight | 308.28 g/mol |
| Exact Mass | 308.04 |
| IUPAC Name | 3,3,3-trifluoro-2-methyl-2-[3-(2-methyl-1,3-thiazol-4-yl)prop-2-enoylamino]propanoic acid |
| SMILES | Cc1nc(C=CC(=O)NC(C)(C(=O)O)C(F)(F)F)cs1 |
| InChI | InChI=1S/C11H11F3N2O3S/c1-6-15-7(5-20-6)3-4-8(17)16-10(2,9(18)19)11(12,13)14/h3-5H,1-2H3,(H,16,17)(H,18,19) |
| InChIKey | KXYVCBMBIAIHOS-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.28 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|