C11H14N2O3S — CID 79022664
(2R)-2-[3-(2-methyl-1,3-thiazol-4-yl)prop-2-enoylamino]butanoic acid (PubChem CID 79022664) has the molecular formula C11H14N2O3S and a molecular weight of 254.31 g/mol. Its IUPAC name is (2R)-2-[3-(2-methyl-1,3-thiazol-4-yl)prop-2-enoylamino]butanoic acid.
| Compound Name | (2R)-2-[3-(2-methyl-1,3-thiazol-4-yl)prop-2-enoylamino]butanoic acid |
|---|---|
| PubChem CID | 79022664 |
| Molecular Formula | C11H14N2O3S |
| Molecular Weight | 254.31 g/mol |
| Exact Mass | 254.07 |
| IUPAC Name | (2R)-2-[3-(2-methyl-1,3-thiazol-4-yl)prop-2-enoylamino]butanoic acid |
| SMILES | CC[C@@H](NC(=O)C=Cc1csc(C)n1)C(=O)O |
| InChI | InChI=1S/C11H14N2O3S/c1-3-9(11(15)16)13-10(14)5-4-8-6-17-7(2)12-8/h4-6,9H,3H2,1-2H3,(H,13,14)(H,15,16)/t9-/m1/s1 |
| InChIKey | PUJXDEVMSPZMPI-SECBINFHSA-N |
| XLogP | 1.44 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.31 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|