C12H15N3O4S — CID 107829849
(2R)-5-amino-2-[[(E)-3-(2-methyl-1,3-thiazol-4-yl)prop-2-enoyl]amino]-5-oxopentanoic acid (PubChem CID 107829849) has the molecular formula C12H15N3O4S and a molecular weight of 297.34 g/mol. Its IUPAC name is (2R)-5-amino-2-[[(E)-3-(2-methyl-1,3-thiazol-4-yl)prop-2-enoyl]amino]-5-oxopentanoic acid.
| Compound Name | (2R)-5-amino-2-[[(E)-3-(2-methyl-1,3-thiazol-4-yl)prop-2-enoyl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 107829849 |
| Molecular Formula | C12H15N3O4S |
| Molecular Weight | 297.34 g/mol |
| Exact Mass | 297.08 |
| IUPAC Name | (2R)-5-amino-2-[[(E)-3-(2-methyl-1,3-thiazol-4-yl)prop-2-enoyl]amino]-5-oxopentanoic acid |
| SMILES | Cc1nc(/C=C/C(=O)N[C@H](CCC(N)=O)C(=O)O)cs1 |
| InChI | InChI=1S/C12H15N3O4S/c1-7-14-8(6-20-7)2-5-11(17)15-9(12(18)19)3-4-10(13)16/h2,5-6,9H,3-4H2,1H3,(H2,13,16)(H,15,17)(H,18,19)/b5-2+/t9-/m1/s1 |
| InChIKey | KESDWSJZVWYVMD-OSOUNJMWSA-N |
| XLogP | 0.30 |
| TPSA | 122.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.34 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|