C10H14N2O3S — CID 79673967
(E)-N-(2-methoxyethoxy)-3-(2-methyl-1,3-thiazol-4-yl)prop-2-enamide (PubChem CID 79673967) has the molecular formula C10H14N2O3S and a molecular weight of 242.30 g/mol. Its IUPAC name is (E)-N-(2-methoxyethoxy)-3-(2-methyl-1,3-thiazol-4-yl)prop-2-enamide.
| Compound Name | (E)-N-(2-methoxyethoxy)-3-(2-methyl-1,3-thiazol-4-yl)prop-2-enamide |
|---|---|
| PubChem CID | 79673967 |
| Molecular Formula | C10H14N2O3S |
| Molecular Weight | 242.30 g/mol |
| Exact Mass | 242.07 |
| IUPAC Name | (E)-N-(2-methoxyethoxy)-3-(2-methyl-1,3-thiazol-4-yl)prop-2-enamide |
| SMILES | COCCONC(=O)/C=C/c1csc(C)n1 |
| InChI | InChI=1S/C10H14N2O3S/c1-8-11-9(7-16-8)3-4-10(13)12-15-6-5-14-2/h3-4,7H,5-6H2,1-2H3,(H,12,13)/b4-3+ |
| InChIKey | SQHHIHFRLONKHU-ONEGZZNKSA-N |
| XLogP | 1.16 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.30 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|