C16H16N2O3S — CID 17423421
methyl 4-[[[(E)-3-(2-methyl-1,3-thiazol-4-yl)prop-2-enoyl]amino]methyl]benzoate (PubChem CID 17423421) has the molecular formula C16H16N2O3S and a molecular weight of 316.38 g/mol. Its IUPAC name is methyl 4-[[[(E)-3-(2-methyl-1,3-thiazol-4-yl)prop-2-enoyl]amino]methyl]benzoate.
| Compound Name | methyl 4-[[[(E)-3-(2-methyl-1,3-thiazol-4-yl)prop-2-enoyl]amino]methyl]benzoate |
|---|---|
| PubChem CID | 17423421 |
| Molecular Formula | C16H16N2O3S |
| Molecular Weight | 316.38 g/mol |
| Exact Mass | 316.09 |
| IUPAC Name | methyl 4-[[[(E)-3-(2-methyl-1,3-thiazol-4-yl)prop-2-enoyl]amino]methyl]benzoate |
| SMILES | COC(=O)c1ccc(CNC(=O)/C=C/c2csc(C)n2)cc1 |
| InChI | InChI=1S/C16H16N2O3S/c1-11-18-14(10-22-11)7-8-15(19)17-9-12-3-5-13(6-4-12)16(20)21-2/h3-8,10H,9H2,1-2H3,(H,17,19)/b8-7+ |
| InChIKey | HPVCSMMFVXIBBJ-BQYQJAHWSA-N |
| XLogP | 2.57 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.38 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|